C24H40N2O — CID 162837488
2-amino-2-[6-methyl-1-[2-[3-(methylaminomethyl)cyclopentyl]ethyl]-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulen-1-yl]acetaldehyde (PubChem CID 162837488) has the molecular formula C24H40N2O and a molecular weight of 372.60 g/mol. Its IUPAC name is 2-amino-2-[6-methyl-1-[2-[3-(methylaminomethyl)cyclopentyl]ethyl]-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulen-1-yl]acetaldehyde.
| Compound Name | 2-amino-2-[6-methyl-1-[2-[3-(methylaminomethyl)cyclopentyl]ethyl]-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulen-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 162837488 |
| Molecular Formula | C24H40N2O |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 372.31 |
| IUPAC Name | 2-amino-2-[6-methyl-1-[2-[3-(methylaminomethyl)cyclopentyl]ethyl]-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulen-1-yl]acetaldehyde |
| SMILES | C=C1CCC2C(C3CC(C)CC13)C2(CCC1CCC(CNC)C1)C(N)C=O |
| InChI | InChI=1S/C24H40N2O/c1-15-10-19-16(2)4-7-21-23(20(19)11-15)24(21,22(25)14-27)9-8-17-5-6-18(12-17)13-26-3/h14-15,17-23,26H,2,4-13,25H2,1,3H3 |
| InChIKey | GIYAHDCKVSHGMU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|