C36H55NO5 — CID 162837827
2-[3'-(1-ethoxy-10-methyl-6-methylideneundeca-2,4,9-trien-2-yl)-2',7-dihydroxy-4-(2-hydroxyethyl)-7-[2-(methylamino)ethyl]spiro[bicyclo[3.3.1]non-2-ene-6,1'-cyclopentane]-9-ylidene]propanal (PubChem CID 162837827) has the molecular formula C36H55NO5 and a molecular weight of 581.84 g/mol. Its IUPAC name is 2-[3'-(1-ethoxy-10-methyl-6-methylideneundeca-2,4,9-trien-2-yl)-2',7-dihydroxy-4-(2-hydroxyethyl)-7-[2-(methylamino)ethyl]spiro[bicyclo[3.3.1]non-2-ene-6,1'-cyclopentane]-9-ylidene]propanal.
| Compound Name | 2-[3'-(1-ethoxy-10-methyl-6-methylideneundeca-2,4,9-trien-2-yl)-2',7-dihydroxy-4-(2-hydroxyethyl)-7-[2-(methylamino)ethyl]spiro[bicyclo[3.3.1]non-2-ene-6,1'-cyclopentane]-9-ylidene]propanal |
|---|---|
| PubChem CID | 162837827 |
| Molecular Formula | C36H55NO5 |
| Molecular Weight | 581.84 g/mol |
| Exact Mass | 581.41 |
| IUPAC Name | 2-[3'-(1-ethoxy-10-methyl-6-methylideneundeca-2,4,9-trien-2-yl)-2',7-dihydroxy-4-(2-hydroxyethyl)-7-[2-(methylamino)ethyl]spiro[bicyclo[3.3.1]non-2-ene-6,1'-cyclopentane]-9-ylidene]propanal |
| SMILES | C=C(C=CC=C(COCC)C1CCC2(C1O)C1C(=C(C)C=O)C(C=CC1CCO)CC2(O)CCNC)CCC=C(C)C |
| InChI | InChI=1S/C36H55NO5/c1-7-42-24-30(13-9-12-26(4)11-8-10-25(2)3)31-16-18-36(34(31)40)33-28(17-21-38)14-15-29(32(33)27(5)23-39)22-35(36,41)19-20-37-6/h9-10,12-15,23,28-29,31,33-34,37-38,40-41H,4,7-8,11,16-22,24H2,1-3,5-6H3 |
| InChIKey | SNYMARVRECXDLV-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.84 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|