C22H25N2O3- — CID 162838463
methyl (E)-2-[(2S,3Z,12bS)-3-ethylidene-1,2,4,6,7,12b-hexahydroindolo[2,3-a]quinolizin-12-id-2-yl]-3-methoxyprop-2-enoate (PubChem CID 162838463) has the molecular formula C22H25N2O3- and a molecular weight of 365.45 g/mol. Its IUPAC name is methyl (E)-2-[(2S,3Z,12bS)-3-ethylidene-1,2,4,6,7,12b-hexahydroindolo[2,3-a]quinolizin-12-id-2-yl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[(2S,3Z,12bS)-3-ethylidene-1,2,4,6,7,12b-hexahydroindolo[2,3-a]quinolizin-12-id-2-yl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 162838463 |
| Molecular Formula | C22H25N2O3- |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | methyl (E)-2-[(2S,3Z,12bS)-3-ethylidene-1,2,4,6,7,12b-hexahydroindolo[2,3-a]quinolizin-12-id-2-yl]-3-methoxyprop-2-enoate |
| SMILES | C/C=C1\CN2CCc3c([n-]c4ccccc34)[C@@H]2C[C@@H]1/C(=C\OC)C(=O)OC |
| InChI | InChI=1S/C22H25N2O3/c1-4-14-12-24-10-9-16-15-7-5-6-8-19(15)23-21(16)20(24)11-17(14)18(13-26-2)22(25)27-3/h4-8,13,17,20H,9-12H2,1-3H3/q-1/b14-4+,18-13+/t17-,20-/m0/s1 |
| InChIKey | NYASZAFKORRGLP-DLTYQINTSA-N |
| XLogP | 3.37 |
| TPSA | 52.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|