C37H50O10 — CID 162838551
12-hydroxy-19-[2-(7-hydroxyheptyl)furan-3-yl]-9,9,13,20-tetramethylspiro[4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-6,1'-cyclopentane]-5,11,17-trione (PubChem CID 162838551) has the molecular formula C37H50O10 and a molecular weight of 654.80 g/mol. Its IUPAC name is 12-hydroxy-19-[2-(7-hydroxyheptyl)furan-3-yl]-9,9,13,20-tetramethylspiro[4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-6,1'-cyclopentane]-5,11,17-trione.
| Compound Name | 12-hydroxy-19-[2-(7-hydroxyheptyl)furan-3-yl]-9,9,13,20-tetramethylspiro[4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-6,1'-cyclopentane]-5,11,17-trione |
|---|---|
| PubChem CID | 162838551 |
| Molecular Formula | C37H50O10 |
| Molecular Weight | 654.80 g/mol |
| Exact Mass | 654.34 |
| IUPAC Name | 12-hydroxy-19-[2-(7-hydroxyheptyl)furan-3-yl]-9,9,13,20-tetramethylspiro[4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-6,1'-cyclopentane]-5,11,17-trione |
| SMILES | CC1(C)OC2C3(CCCC3)C(=O)OCC23C1C(=O)C(O)C1(C)C3CCC2(C)C(c3ccoc3CCCCCCCO)OC(=O)C3OC321 |
| InChI | InChI=1S/C37H50O10/c1-32(2)25-24(39)26(40)34(4)23(36(25)20-44-31(42)35(30(36)47-32)15-9-10-16-35)13-17-33(3)27(45-29(41)28-37(33,34)46-28)21-14-19-43-22(21)12-8-6-5-7-11-18-38/h14,19,23,25-28,30,38,40H,5-13,15-18,20H2,1-4H3 |
| InChIKey | SKKYBVYSOXQUGR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 145.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.80 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|