C28H32O10 — CID 162838720
1-[8-[(2S,3R,4S,5S,6R)-6-[(1R,3S)-1,3-dihydroxy-3-phenylpropyl]-3,4,5-trihydroxyoxan-2-yl]oxy-1-hydroxy-6-methoxy-3-methylnaphthalen-2-yl]ethanone (PubChem CID 162838720) has the molecular formula C28H32O10 and a molecular weight of 528.55 g/mol. Its IUPAC name is 1-[8-[(2S,3R,4S,5S,6R)-6-[(1R,3S)-1,3-dihydroxy-3-phenylpropyl]-3,4,5-trihydroxyoxan-2-yl]oxy-1-hydroxy-6-methoxy-3-methylnaphthalen-2-yl]ethanone.
| Compound Name | 1-[8-[(2S,3R,4S,5S,6R)-6-[(1R,3S)-1,3-dihydroxy-3-phenylpropyl]-3,4,5-trihydroxyoxan-2-yl]oxy-1-hydroxy-6-methoxy-3-methylnaphthalen-2-yl]ethanone |
|---|---|
| PubChem CID | 162838720 |
| Molecular Formula | C28H32O10 |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 1-[8-[(2S,3R,4S,5S,6R)-6-[(1R,3S)-1,3-dihydroxy-3-phenylpropyl]-3,4,5-trihydroxyoxan-2-yl]oxy-1-hydroxy-6-methoxy-3-methylnaphthalen-2-yl]ethanone |
| SMILES | COc1cc(O[C@@H]2O[C@H]([C@H](O)C[C@H](O)c3ccccc3)[C@@H](O)[C@H](O)[C@H]2O)c2c(O)c(C(C)=O)c(C)cc2c1 |
| InChI | InChI=1S/C28H32O10/c1-13-9-16-10-17(36-3)11-20(22(16)23(32)21(13)14(2)29)37-28-26(35)24(33)25(34)27(38-28)19(31)12-18(30)15-7-5-4-6-8-15/h4-11,18-19,24-28,30-35H,12H2,1-3H3/t18-,19+,24-,25-,26+,27+,28+/m0/s1 |
| InChIKey | LEUYNQUVXIKYON-GPQOOMGTSA-N |
| XLogP | 1.74 |
| TPSA | 166.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |