C39H54O9 — CID 162839269
12-hydroxy-9,13,20-trimethyl-9-(3-methylbutyl)-19-(2-pentylfuran-3-yl)spiro[4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-6,1'-cyclopentane]-5,11,17-trione (PubChem CID 162839269) has the molecular formula C39H54O9 and a molecular weight of 666.85 g/mol. Its IUPAC name is 12-hydroxy-9,13,20-trimethyl-9-(3-methylbutyl)-19-(2-pentylfuran-3-yl)spiro[4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-6,1'-cyclopentane]-5,11,17-trione.
| Compound Name | 12-hydroxy-9,13,20-trimethyl-9-(3-methylbutyl)-19-(2-pentylfuran-3-yl)spiro[4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-6,1'-cyclopentane]-5,11,17-trione |
|---|---|
| PubChem CID | 162839269 |
| Molecular Formula | C39H54O9 |
| Molecular Weight | 666.85 g/mol |
| Exact Mass | 666.38 |
| IUPAC Name | 12-hydroxy-9,13,20-trimethyl-9-(3-methylbutyl)-19-(2-pentylfuran-3-yl)spiro[4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-6,1'-cyclopentane]-5,11,17-trione |
| SMILES | CCCCCc1occc1C1OC(=O)C2OC23C1(C)CCC1C24COC(=O)C5(CCCC5)C2OC(C)(CCC(C)C)C4C(=O)C(O)C13C |
| InChI | InChI=1S/C39H54O9/c1-7-8-9-12-24-23(15-20-44-24)29-34(4)18-14-25-36(6,39(34)30(47-39)31(42)46-29)28(41)26(40)27-35(5,19-13-22(2)3)48-32-37(16-10-11-17-37)33(43)45-21-38(25,27)32/h15,20,22,25,27-30,32,41H,7-14,16-19,21H2,1-6H3 |
| InChIKey | SXTMAFCPXQENSG-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.85 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|