C37H60O4 — CID 162839355
(1R,4S,5R,8S,11R,13R,14S,16S,19S,21S,24S,25R,26R)-14-hexyl-21-hydroxy-5,8,11,25,26-pentamethyl-22-oxaheptacyclo[14.7.2.11,21.04,25.05,14.08,13.019,24]hexacosane-11-carboxylic acid (PubChem CID 162839355) has the molecular formula C37H60O4 and a molecular weight of 568.88 g/mol. Its IUPAC name is (1R,4S,5R,8S,11R,13R,14S,16S,19S,21S,24S,25R,26R)-14-hexyl-21-hydroxy-5,8,11,25,26-pentamethyl-22-oxaheptacyclo[14.7.2.11,21.04,25.05,14.08,13.019,24]hexacosane-11-carboxylic acid.
| Compound Name | (1R,4S,5R,8S,11R,13R,14S,16S,19S,21S,24S,25R,26R)-14-hexyl-21-hydroxy-5,8,11,25,26-pentamethyl-22-oxaheptacyclo[14.7.2.11,21.04,25.05,14.08,13.019,24]hexacosane-11-carboxylic acid |
|---|---|
| PubChem CID | 162839355 |
| Molecular Formula | C37H60O4 |
| Molecular Weight | 568.88 g/mol |
| Exact Mass | 568.45 |
| IUPAC Name | (1R,4S,5R,8S,11R,13R,14S,16S,19S,21S,24S,25R,26R)-14-hexyl-21-hydroxy-5,8,11,25,26-pentamethyl-22-oxaheptacyclo[14.7.2.11,21.04,25.05,14.08,13.019,24]hexacosane-11-carboxylic acid |
| SMILES | CCCCCC[C@@]12C[C@@H]3CC[C@H]4C[C@]5(O)OC[C@@]6(CC[C@@H]([C@]3(C)[C@H]46)[C@@]1(C)CC[C@@]1(C)CC[C@@](C)(C(=O)O)C[C@H]12)[C@H]5C |
| InChI | InChI=1S/C37H60O4/c1-7-8-9-10-14-36-21-26-12-11-25-20-37(40)24(2)35(23-41-37)15-13-27(34(26,6)29(25)35)33(36,5)19-18-31(3)16-17-32(4,30(38)39)22-28(31)36/h24-29,40H,7-23H2,1-6H3,(H,38,39)/t24-,25+,26+,27-,28-,29+,31-,32-,33-,34-,35+,36+,37+/m1/s1 |
| InChIKey | VDDKIMHOHSAHRK-HAVAHHHPSA-N |
| XLogP | 8.85 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.88 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|