C75H84N4O14 — CID 162840561
CID 162840561 (PubChem CID 162840561) has the molecular formula C75H84N4O14 and a molecular weight of 1265.51 g/mol.
| Compound Name | CID 162840561 |
|---|---|
| PubChem CID | 162840561 |
| Molecular Formula | C75H84N4O14 |
| Molecular Weight | 1265.51 g/mol |
| Exact Mass | 1264.60 |
| IUPAC Name | — |
| SMILES | COc1cc2c(cc1O)C1=CC3CC4(CC5(NC(C(C)O)CC6CCc7ccc(O)cc7-c7cc8[nH]ccc8n7C65)C(CCCO)C4C=O)C4CC(O)CCC4C3C2CC(=O)CC(C(O)Cc2ccc(O)c(OCCO)c2)OC(=O)CC#CCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C75H84N4O14/c1-40(83)60-29-43-15-14-42-16-17-45(84)30-51(42)63-36-61-62(21-22-76-61)79(63)73(43)75(78-60)39-74(58(38-82)56(75)10-7-23-80)37-44-28-55-52-34-66(89)67(91-2)35-53(52)54(71(44)50-19-18-46(85)32-57(50)74)31-47(86)33-69(65(88)26-41-13-20-64(87)68(27-41)92-25-24-81)93-70(90)12-6-4-9-49-48-8-3-5-11-59(48)77-72(49)55/h3,5,8,11,13,16-17,20-22,27-28,30,34-36,38,40,43-44,46,50,54,56-58,60,65,69,71,73,76-78,80-81,83-85,87-89H,7,9-10,12,14-15,18-19,23-26,29,31-33,37,39H2,1-2H3 |
| InChIKey | WEVZOOWQRPOOOT-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 289.28 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 93 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1265.51 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|