C36H48O9 — CID 162841194
13-cyclohexyl-12-hydroxy-9,9,20-trimethyl-19-(2-pentylfuran-3-yl)-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,11,17-trione (PubChem CID 162841194) has the molecular formula C36H48O9 and a molecular weight of 624.77 g/mol. Its IUPAC name is 13-cyclohexyl-12-hydroxy-9,9,20-trimethyl-19-(2-pentylfuran-3-yl)-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,11,17-trione.
| Compound Name | 13-cyclohexyl-12-hydroxy-9,9,20-trimethyl-19-(2-pentylfuran-3-yl)-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,11,17-trione |
|---|---|
| PubChem CID | 162841194 |
| Molecular Formula | C36H48O9 |
| Molecular Weight | 624.77 g/mol |
| Exact Mass | 624.33 |
| IUPAC Name | 13-cyclohexyl-12-hydroxy-9,9,20-trimethyl-19-(2-pentylfuran-3-yl)-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,11,17-trione |
| SMILES | CCCCCc1occc1C1OC(=O)C2OC23C1(C)CCC1C24COC(=O)CC2OC(C)(C)C4C(=O)C(O)C13C1CCCCC1 |
| InChI | InChI=1S/C36H48O9/c1-5-6-8-13-22-21(15-17-41-22)29-33(4)16-14-23-34-19-42-25(37)18-24(34)44-32(2,3)27(34)26(38)28(39)35(23,20-11-9-7-10-12-20)36(33)30(45-36)31(40)43-29/h15,17,20,23-24,27-30,39H,5-14,16,18-19H2,1-4H3 |
| InChIKey | NFBDMXLHHCEQOS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.77 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|