C29H26O9 — CID 162841449
(1R,17S,22S,23R,24R,25S)-4,23,24,25-tetrahydroxy-17-phenyl-2,20,26-trioxapentacyclo[20.3.1.03,16.05,14.07,12]hexacosa-3,5(14),7,9,11,15-hexaene-6,13-dione (PubChem CID 162841449) has the molecular formula C29H26O9 and a molecular weight of 518.52 g/mol. Its IUPAC name is (1R,17S,22S,23R,24R,25S)-4,23,24,25-tetrahydroxy-17-phenyl-2,20,26-trioxapentacyclo[20.3.1.03,16.05,14.07,12]hexacosa-3,5(14),7,9,11,15-hexaene-6,13-dione.
| Compound Name | (1R,17S,22S,23R,24R,25S)-4,23,24,25-tetrahydroxy-17-phenyl-2,20,26-trioxapentacyclo[20.3.1.03,16.05,14.07,12]hexacosa-3,5(14),7,9,11,15-hexaene-6,13-dione |
|---|---|
| PubChem CID | 162841449 |
| Molecular Formula | C29H26O9 |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | (1R,17S,22S,23R,24R,25S)-4,23,24,25-tetrahydroxy-17-phenyl-2,20,26-trioxapentacyclo[20.3.1.03,16.05,14.07,12]hexacosa-3,5(14),7,9,11,15-hexaene-6,13-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc1c(c2O)O[C@H]2O[C@@H](COCC[C@H]1c1ccccc1)[C@H](O)[C@@H](O)[C@@H]2O |
| InChI | InChI=1S/C29H26O9/c30-22-16-8-4-5-9-17(16)23(31)21-19(22)12-18-15(14-6-2-1-3-7-14)10-11-36-13-20-24(32)26(34)27(35)29(37-20)38-28(18)25(21)33/h1-9,12,15,20,24,26-27,29,32-35H,10-11,13H2/t15-,20-,24-,26+,27-,29+/m0/s1 |
| InChIKey | ZVWGYALFXZAQMM-SZOXWNNESA-N |
| XLogP | 1.91 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|