C70H94N2O11 — CID 162841546
CID 162841546 (PubChem CID 162841546) has the molecular formula C70H94N2O11 and a molecular weight of 1139.52 g/mol.
| Compound Name | CID 162841546 |
|---|---|
| PubChem CID | 162841546 |
| Molecular Formula | C70H94N2O11 |
| Molecular Weight | 1139.52 g/mol |
| Exact Mass | 1138.69 |
| IUPAC Name | — |
| SMILES | C[C@@]12CC[C@@H]3[C@@]45COC(=O)[C@]6(CC[C@@]7(CCC8(CCCC8)C7)C6)[C@@H]4O[C@](C)(C4CCCCC4)[C@H]5C(=O)[C@@H](O)[C@@]3([C@H]3CCC[C@@H](Cc4ccccc4)C3)[C@]13O[C@@H]3C(=O)O[C@H]2c1ccoc1C[C@@H]([C@@H]1CC[C@@H]2[C@H](C=CN3CNC[C@@H]23)C1)[C@H](O)CO |
| InChI | InChI=1S/C70H94N2O11/c1-63-25-20-54-68-40-80-62(78)67(29-28-66(39-67)27-26-65(38-66)23-9-10-24-65)61(68)83-64(2,46-15-7-4-8-16-46)56(68)55(75)57(76)69(54,47-17-11-14-43(33-47)32-42-12-5-3-6-13-42)70(63)59(82-70)60(77)81-58(63)49-22-31-79-53(49)35-50(52(74)37-73)44-18-19-48-45(34-44)21-30-72-41-71-36-51(48)72/h3,5-6,12-13,21-22,30-31,43-48,50-52,54,56-59,61,71,73-74,76H,4,7-11,14-20,23-29,32-41H2,1-2H3/t43-,44+,45+,47-,48+,50-,51-,52+,54+,56+,57+,58-,59+,61-,63-,64+,66+,67-,68+,69-,70+/m0/s1 |
| InChIKey | ZTWMAQAAGKIAGS-TXPLAGBHSA-N |
| XLogP | 10.51 |
| TPSA | 180.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 83 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1139.52 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|