C30H40O11 — CID 162841670
6-acetyl-5,8-dihydroxy-7-methyl-4-[3,4,5-trihydroxy-6-(1-hydroxy-2-pentylcyclohexyl)oxan-2-yl]oxynaphthalene-2-carboxylic acid (PubChem CID 162841670) has the molecular formula C30H40O11 and a molecular weight of 576.64 g/mol. Its IUPAC name is 6-acetyl-5,8-dihydroxy-7-methyl-4-[3,4,5-trihydroxy-6-(1-hydroxy-2-pentylcyclohexyl)oxan-2-yl]oxynaphthalene-2-carboxylic acid.
| Compound Name | 6-acetyl-5,8-dihydroxy-7-methyl-4-[3,4,5-trihydroxy-6-(1-hydroxy-2-pentylcyclohexyl)oxan-2-yl]oxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 162841670 |
| Molecular Formula | C30H40O11 |
| Molecular Weight | 576.64 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | 6-acetyl-5,8-dihydroxy-7-methyl-4-[3,4,5-trihydroxy-6-(1-hydroxy-2-pentylcyclohexyl)oxan-2-yl]oxynaphthalene-2-carboxylic acid |
| SMILES | CCCCCC1CCCCC1(O)C1OC(Oc2cc(C(=O)O)cc3c(O)c(C)c(C(C)=O)c(O)c23)C(O)C(O)C1O |
| InChI | InChI=1S/C30H40O11/c1-4-5-6-9-17-10-7-8-11-30(17,39)27-25(35)24(34)26(36)29(41-27)40-19-13-16(28(37)38)12-18-21(19)23(33)20(15(3)31)14(2)22(18)32/h12-13,17,24-27,29,32-36,39H,4-11H2,1-3H3,(H,37,38) |
| InChIKey | DEKUEXCIRXNTPY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 194.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.64 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|