C35H44O7 — CID 162841901
(2S,3R,6S)-2-[4-hydroxy-3-methoxy-5-(3-methylbutoxy)phenyl]-11-methoxy-6-(3-methylbutyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol (PubChem CID 162841901) has the molecular formula C35H44O7 and a molecular weight of 576.73 g/mol. Its IUPAC name is (2S,3R,6S)-2-[4-hydroxy-3-methoxy-5-(3-methylbutoxy)phenyl]-11-methoxy-6-(3-methylbutyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol.
| Compound Name | (2S,3R,6S)-2-[4-hydroxy-3-methoxy-5-(3-methylbutoxy)phenyl]-11-methoxy-6-(3-methylbutyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol |
|---|---|
| PubChem CID | 162841901 |
| Molecular Formula | C35H44O7 |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | (2S,3R,6S)-2-[4-hydroxy-3-methoxy-5-(3-methylbutoxy)phenyl]-11-methoxy-6-(3-methylbutyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol |
| SMILES | COc1cc([C@@H]2Oc3cc(OC)c4c(c3C[C@H]2O)C[C@H](CCC(C)C)c2cc(O)ccc2-4)cc(OCCC(C)C)c1O |
| InChI | InChI=1S/C35H44O7/c1-19(2)7-8-21-13-27-26-17-28(37)35(22-14-31(40-6)34(38)32(15-22)41-12-11-20(3)4)42-29(26)18-30(39-5)33(27)24-10-9-23(36)16-25(21)24/h9-10,14-16,18-21,28,35-38H,7-8,11-13,17H2,1-6H3/t21-,28+,35-/m0/s1 |
| InChIKey | XWQHJTFYYRFSMK-RAANXJLESA-N |
| XLogP | 7.32 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |