C35H47NO — CID 162841917
3-[(2R,4aR,6S,10bS)-2-methyl-1,2,3,4,4a,5,6,10b-octahydrobenzo[h]quinolin-6-yl]-5-[[(1S,3S)-3-[(1S,5S)-1,5-dimethylcyclohex-2-en-1-yl]cyclohexyl]methyl]phenol (PubChem CID 162841917) has the molecular formula C35H47NO and a molecular weight of 497.77 g/mol. Its IUPAC name is 3-[(2R,4aR,6S,10bS)-2-methyl-1,2,3,4,4a,5,6,10b-octahydrobenzo[h]quinolin-6-yl]-5-[[(1S,3S)-3-[(1S,5S)-1,5-dimethylcyclohex-2-en-1-yl]cyclohexyl]methyl]phenol.
| Compound Name | 3-[(2R,4aR,6S,10bS)-2-methyl-1,2,3,4,4a,5,6,10b-octahydrobenzo[h]quinolin-6-yl]-5-[[(1S,3S)-3-[(1S,5S)-1,5-dimethylcyclohex-2-en-1-yl]cyclohexyl]methyl]phenol |
|---|---|
| PubChem CID | 162841917 |
| Molecular Formula | C35H47NO |
| Molecular Weight | 497.77 g/mol |
| Exact Mass | 497.37 |
| IUPAC Name | 3-[(2R,4aR,6S,10bS)-2-methyl-1,2,3,4,4a,5,6,10b-octahydrobenzo[h]quinolin-6-yl]-5-[[(1S,3S)-3-[(1S,5S)-1,5-dimethylcyclohex-2-en-1-yl]cyclohexyl]methyl]phenol |
| SMILES | C[C@H]1CC=C[C@](C)([C@H]2CCC[C@H](Cc3cc(O)cc([C@@H]4C[C@H]5CC[C@@H](C)N[C@@H]5c5ccccc54)c3)C2)C1 |
| InChI | InChI=1S/C35H47NO/c1-23-8-7-15-35(3,22-23)29-10-6-9-25(18-29)16-26-17-28(20-30(37)19-26)33-21-27-14-13-24(2)36-34(27)32-12-5-4-11-31(32)33/h4-5,7,11-12,15,17,19-20,23-25,27,29,33-34,36-37H,6,8-10,13-14,16,18,21-22H2,1-3H3/t23-,24+,25+,27+,29-,33-,34-,35-/m0/s1 |
| InChIKey | BAEPZEBSQRTDFX-SWWQCKJYSA-N |
| XLogP | 8.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.77 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|