C28H24O7 — CID 162842333
9-benzoyl-3-hydroxy-2-(2-hydroxypropan-2-yl)-4-methoxy-5-phenyl-2,3-dihydrofuro[3,2-g]chromen-7-one (PubChem CID 162842333) has the molecular formula C28H24O7 and a molecular weight of 472.49 g/mol. Its IUPAC name is 9-benzoyl-3-hydroxy-2-(2-hydroxypropan-2-yl)-4-methoxy-5-phenyl-2,3-dihydrofuro[3,2-g]chromen-7-one.
| Compound Name | 9-benzoyl-3-hydroxy-2-(2-hydroxypropan-2-yl)-4-methoxy-5-phenyl-2,3-dihydrofuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 162842333 |
| Molecular Formula | C28H24O7 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 9-benzoyl-3-hydroxy-2-(2-hydroxypropan-2-yl)-4-methoxy-5-phenyl-2,3-dihydrofuro[3,2-g]chromen-7-one |
| SMILES | COc1c2c(c(C(=O)c3ccccc3)c3oc(=O)cc(-c4ccccc4)c13)OC(C(C)(C)O)C2O |
| InChI | InChI=1S/C28H24O7/c1-28(2,32)27-23(31)21-24(33-3)19-17(15-10-6-4-7-11-15)14-18(29)34-25(19)20(26(21)35-27)22(30)16-12-8-5-9-13-16/h4-14,23,27,31-32H,1-3H3 |
| InChIKey | PIVLHMBRCYLGSY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|