C14H22O9 — CID 162842664
[(2S,3S,4S)-2-methyl-4-[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-3-yl] acetate (PubChem CID 162842664) has the molecular formula C14H22O9 and a molecular weight of 334.32 g/mol. Its IUPAC name is [(2S,3S,4S)-2-methyl-4-[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-3-yl] acetate.
| Compound Name | [(2S,3S,4S)-2-methyl-4-[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-3-yl] acetate |
|---|---|
| PubChem CID | 162842664 |
| Molecular Formula | C14H22O9 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | [(2S,3S,4S)-2-methyl-4-[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](C)OC=C[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H22O9/c1-6-13(21-7(2)16)8(3-4-20-6)22-14-12(19)11(18)10(17)9(5-15)23-14/h3-4,6,8-15,17-19H,5H2,1-2H3/t6-,8-,9+,10-,11+,12-,13-,14+/m0/s1 |
| InChIKey | BDFGGCOEKXWNGX-PBBUGPFTSA-N |
| XLogP | -1.96 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |