C32H54O7 — CID 162842730
(3R,4S,5R,6S)-4-hydroxy-3,5-dimethyl-6-[(2S,5S,6S,7S,11S,12R,13S,14S,15S)-2,6,12,14-tetrahydroxy-5,7,9,11,13,15-hexamethylnonadeca-3,8,16,18-tetraenyl]oxan-2-one (PubChem CID 162842730) has the molecular formula C32H54O7 and a molecular weight of 550.78 g/mol. Its IUPAC name is (3R,4S,5R,6S)-4-hydroxy-3,5-dimethyl-6-[(2S,5S,6S,7S,11S,12R,13S,14S,15S)-2,6,12,14-tetrahydroxy-5,7,9,11,13,15-hexamethylnonadeca-3,8,16,18-tetraenyl]oxan-2-one.
| Compound Name | (3R,4S,5R,6S)-4-hydroxy-3,5-dimethyl-6-[(2S,5S,6S,7S,11S,12R,13S,14S,15S)-2,6,12,14-tetrahydroxy-5,7,9,11,13,15-hexamethylnonadeca-3,8,16,18-tetraenyl]oxan-2-one |
|---|---|
| PubChem CID | 162842730 |
| Molecular Formula | C32H54O7 |
| Molecular Weight | 550.78 g/mol |
| Exact Mass | 550.39 |
| IUPAC Name | (3R,4S,5R,6S)-4-hydroxy-3,5-dimethyl-6-[(2S,5S,6S,7S,11S,12R,13S,14S,15S)-2,6,12,14-tetrahydroxy-5,7,9,11,13,15-hexamethylnonadeca-3,8,16,18-tetraenyl]oxan-2-one |
| SMILES | C=CC=C[C@H](C)[C@H](O)[C@@H](C)[C@H](O)[C@@H](C)CC(C)=C[C@H](C)[C@@H](O)[C@@H](C)C=C[C@@H](O)C[C@@H]1OC(=O)[C@H](C)[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C32H54O7/c1-10-11-12-19(3)29(35)24(8)30(36)22(6)16-18(2)15-21(5)28(34)20(4)13-14-26(33)17-27-23(7)31(37)25(9)32(38)39-27/h10-15,19-31,33-37H,1,16-17H2,2-9H3/t19-,20-,21-,22-,23-,24+,25+,26+,27-,28-,29-,30+,31-/m0/s1 |
| InChIKey | HRCSHZDPOQFJRN-YTHBJIEJSA-N |
| XLogP | 4.19 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.78 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|