C19H36O — CID 162843019
(6R,10R)-6,10,14-trimethyl-2-methylidenepentadecanal (PubChem CID 162843019) has the molecular formula C19H36O and a molecular weight of 280.50 g/mol. Its IUPAC name is (6R,10R)-6,10,14-trimethyl-2-methylidenepentadecanal.
| Compound Name | (6R,10R)-6,10,14-trimethyl-2-methylidenepentadecanal |
|---|---|
| PubChem CID | 162843019 |
| Molecular Formula | C19H36O |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.28 |
| IUPAC Name | (6R,10R)-6,10,14-trimethyl-2-methylidenepentadecanal |
| SMILES | C=C(C=O)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C19H36O/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)15-20/h15-18H,5-14H2,1-4H3/t17-,18-/m1/s1 |
| InChIKey | PTFJEDBJXCZCDO-QZTJIDSGSA-N |
| XLogP | 6.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|