C35H44O6 — CID 162843129
(3S)-3-[(2R,3R,6S)-6-[[(1R,3S)-2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl]methyl]-7-hydroxy-2,3-dimethyl-6-(3-methylbut-2-enyl)-4,5-dioxo-2,3-dihydrochromen-8-yl]-3-phenylpropanoic acid (PubChem CID 162843129) has the molecular formula C35H44O6 and a molecular weight of 560.73 g/mol. Its IUPAC name is (3S)-3-[(2R,3R,6S)-6-[[(1R,3S)-2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl]methyl]-7-hydroxy-2,3-dimethyl-6-(3-methylbut-2-enyl)-4,5-dioxo-2,3-dihydrochromen-8-yl]-3-phenylpropanoic acid.
| Compound Name | (3S)-3-[(2R,3R,6S)-6-[[(1R,3S)-2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl]methyl]-7-hydroxy-2,3-dimethyl-6-(3-methylbut-2-enyl)-4,5-dioxo-2,3-dihydrochromen-8-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 162843129 |
| Molecular Formula | C35H44O6 |
| Molecular Weight | 560.73 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | (3S)-3-[(2R,3R,6S)-6-[[(1R,3S)-2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl]methyl]-7-hydroxy-2,3-dimethyl-6-(3-methylbut-2-enyl)-4,5-dioxo-2,3-dihydrochromen-8-yl]-3-phenylpropanoic acid |
| SMILES | C=C(C)[C@@H]1C[C@H](C[C@]2(CC=C(C)C)C(=O)C3=C(O[C@H](C)[C@@H](C)C3=O)C([C@@H](CC(=O)O)c3ccccc3)=C2O)C1(C)C |
| InChI | InChI=1S/C35H44O6/c1-19(2)14-15-35(18-24-16-26(20(3)4)34(24,7)8)32(39)28(25(17-27(36)37)23-12-10-9-11-13-23)31-29(33(35)40)30(38)21(5)22(6)41-31/h9-14,21-22,24-26,39H,3,15-18H2,1-2,4-8H3,(H,36,37)/t21-,22-,24-,25+,26+,35+/m1/s1 |
| InChIKey | FLGWKMXAOWPYPP-AJORTJKTSA-N |
| XLogP | 7.49 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.73 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|