C20H26O4 — CID 162843439
(2S)-5-(4-methylpent-3-enyl)-2-[(E)-5-(5-oxo-2H-furan-4-yl)pent-2-en-2-yl]-2,3-dihydropyran-6-one (PubChem CID 162843439) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (2S)-5-(4-methylpent-3-enyl)-2-[(E)-5-(5-oxo-2H-furan-4-yl)pent-2-en-2-yl]-2,3-dihydropyran-6-one.
| Compound Name | (2S)-5-(4-methylpent-3-enyl)-2-[(E)-5-(5-oxo-2H-furan-4-yl)pent-2-en-2-yl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 162843439 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (2S)-5-(4-methylpent-3-enyl)-2-[(E)-5-(5-oxo-2H-furan-4-yl)pent-2-en-2-yl]-2,3-dihydropyran-6-one |
| SMILES | CC(C)=CCCC1=CC[C@@H](/C(C)=C/CCC2=CCOC2=O)OC1=O |
| InChI | InChI=1S/C20H26O4/c1-14(2)6-4-8-16-10-11-18(24-20(16)22)15(3)7-5-9-17-12-13-23-19(17)21/h6-7,10,12,18H,4-5,8-9,11,13H2,1-3H3/b15-7+/t18-/m0/s1 |
| InChIKey | PRLXHEUKWIVTBJ-APSGNOSNSA-N |
| XLogP | 4.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|