C40H52O3 — CID 162843574
4-[18-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-3-ene-1,2-dione (PubChem CID 162843574) has the molecular formula C40H52O3 and a molecular weight of 580.85 g/mol. Its IUPAC name is 4-[18-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-3-ene-1,2-dione.
| Compound Name | 4-[18-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-3-ene-1,2-dione |
|---|---|
| PubChem CID | 162843574 |
| Molecular Formula | C40H52O3 |
| Molecular Weight | 580.85 g/mol |
| Exact Mass | 580.39 |
| IUPAC Name | 4-[18-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-3-ene-1,2-dione |
| SMILES | CC(C=CC=C(C)C=CC1=C(C)C(=O)C(=O)CC1(C)C)=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)C(O)CCC1(C)C |
| InChI | InChI=1S/C40H52O3/c1-28(17-13-19-30(3)21-23-34-32(5)36(41)25-26-39(34,7)8)15-11-12-16-29(2)18-14-20-31(4)22-24-35-33(6)38(43)37(42)27-40(35,9)10/h11-24,36,41H,25-27H2,1-10H3 |
| InChIKey | FTFLRDLAJALOKH-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.85 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|