C20H28O4 — CID 162843586
(1S,3S,5S,13R,15S,16R)-5,13-dihydroxy-3,15-dimethyl-6-propan-2-yl-12-oxatetracyclo[8.5.1.03,7.013,16]hexadeca-6,9-dien-11-one (PubChem CID 162843586) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (1S,3S,5S,13R,15S,16R)-5,13-dihydroxy-3,15-dimethyl-6-propan-2-yl-12-oxatetracyclo[8.5.1.03,7.013,16]hexadeca-6,9-dien-11-one.
| Compound Name | (1S,3S,5S,13R,15S,16R)-5,13-dihydroxy-3,15-dimethyl-6-propan-2-yl-12-oxatetracyclo[8.5.1.03,7.013,16]hexadeca-6,9-dien-11-one |
|---|---|
| PubChem CID | 162843586 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (1S,3S,5S,13R,15S,16R)-5,13-dihydroxy-3,15-dimethyl-6-propan-2-yl-12-oxatetracyclo[8.5.1.03,7.013,16]hexadeca-6,9-dien-11-one |
| SMILES | CC(C)C1=C2CC=C3C(=O)O[C@]4(O)C[C@H](C)[C@H](C[C@@]2(C)C[C@@H]1O)[C@H]34 |
| InChI | InChI=1S/C20H28O4/c1-10(2)16-14-6-5-12-17-13(8-19(14,4)9-15(16)21)11(3)7-20(17,23)24-18(12)22/h5,10-11,13,15,17,21,23H,6-9H2,1-4H3/t11-,13-,15-,17-,19-,20+/m0/s1 |
| InChIKey | WEFXSEUQARFDAB-JEIHSIBVSA-N |
| XLogP | 2.95 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|