C19H16N2 — CID 162843775
12,16,17,18-tetrahydroyohimban (PubChem CID 162843775) has the molecular formula C19H16N2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 12,16,17,18-tetrahydroyohimban.
| Compound Name | 12,16,17,18-tetrahydroyohimban |
|---|---|
| PubChem CID | 162843775 |
| Molecular Formula | C19H16N2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 12,16,17,18-tetrahydroyohimban |
| SMILES | C1=C2C=C3C4=Nc5ccccc5C4=CCN3C=C2CCC1 |
| InChI | InChI=1S/C19H16N2/c1-2-6-14-12-21-10-9-16-15-7-3-4-8-17(15)20-19(16)18(21)11-13(14)5-1/h3-5,7-9,11-12H,1-2,6,10H2 |
| InChIKey | QGSZPWIANAPIKL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |