C20H34O2 — CID 162843826
(6S,10E,14S)-14-hydroxy-2,6,10,14-tetramethylhexadeca-2,10,15-trien-5-one (PubChem CID 162843826) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (6S,10E,14S)-14-hydroxy-2,6,10,14-tetramethylhexadeca-2,10,15-trien-5-one.
| Compound Name | (6S,10E,14S)-14-hydroxy-2,6,10,14-tetramethylhexadeca-2,10,15-trien-5-one |
|---|---|
| PubChem CID | 162843826 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (6S,10E,14S)-14-hydroxy-2,6,10,14-tetramethylhexadeca-2,10,15-trien-5-one |
| SMILES | C=C[C@@](C)(O)CC/C=C(\C)CCC[C@H](C)C(=O)CC=C(C)C |
| InChI | InChI=1S/C20H34O2/c1-7-20(6,22)15-9-11-17(4)10-8-12-18(5)19(21)14-13-16(2)3/h7,11,13,18,22H,1,8-10,12,14-15H2,2-6H3/b17-11+/t18-,20+/m0/s1 |
| InChIKey | ZDDXFQXJFFBYPQ-GOCHRTQFSA-N |
| XLogP | 5.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|