C36H62 — CID 162843917
(3R,7R,10S,11E,13R,16R,20R,21Z)-10-ethenyl-21-ethyl-2,3,7,10,13,16,20-heptamethyl-6,17-dimethylidenetricosa-1,11,21-triene (PubChem CID 162843917) has the molecular formula C36H62 and a molecular weight of 494.89 g/mol. Its IUPAC name is (3R,7R,10S,11E,13R,16R,20R,21Z)-10-ethenyl-21-ethyl-2,3,7,10,13,16,20-heptamethyl-6,17-dimethylidenetricosa-1,11,21-triene.
| Compound Name | (3R,7R,10S,11E,13R,16R,20R,21Z)-10-ethenyl-21-ethyl-2,3,7,10,13,16,20-heptamethyl-6,17-dimethylidenetricosa-1,11,21-triene |
|---|---|
| PubChem CID | 162843917 |
| Molecular Formula | C36H62 |
| Molecular Weight | 494.89 g/mol |
| Exact Mass | 494.49 |
| IUPAC Name | (3R,7R,10S,11E,13R,16R,20R,21Z)-10-ethenyl-21-ethyl-2,3,7,10,13,16,20-heptamethyl-6,17-dimethylidenetricosa-1,11,21-triene |
| SMILES | C=C[C@@](C)(/C=C/[C@H](C)CC[C@@H](C)C(=C)CC[C@@H](C)/C(=C\C)CC)CC[C@@H](C)C(=C)CC[C@@H](C)C(=C)C |
| InChI | InChI=1S/C36H62/c1-14-35(15-2)34(12)22-21-31(9)30(8)18-17-28(6)23-25-36(13,16-3)26-24-33(11)32(10)20-19-29(7)27(4)5/h14,16,23,25,28-30,33-34H,3-4,9-10,15,17-22,24,26H2,1-2,5-8,11-13H3/b25-23+,35-14-/t28-,29-,30-,33-,34-,36+/m1/s1 |
| InChIKey | BBRZPONXDFTDBR-FDUSEYOISA-N |
| XLogP | 12.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.89 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|