C8H8O5 — CID 162844244
(1R,6S)-3-hydroxy-4-methoxy-1-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione (PubChem CID 162844244) has the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. Its IUPAC name is (1R,6S)-3-hydroxy-4-methoxy-1-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione.
| Compound Name | (1R,6S)-3-hydroxy-4-methoxy-1-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
|---|---|
| PubChem CID | 162844244 |
| Molecular Formula | C8H8O5 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | (1R,6S)-3-hydroxy-4-methoxy-1-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
| SMILES | COC1=C(O)C(=O)[C@]2(C)O[C@@H]2C1=O |
| InChI | InChI=1S/C8H8O5/c1-8-6(11)3(9)5(12-2)4(10)7(8)13-8/h7,9H,1-2H3/t7-,8+/m1/s1 |
| InChIKey | MCUVXXYOZCGKSY-SFYZADRCSA-N |
| XLogP | -0.29 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|