C18H28O3 — CID 162844429
(3R,5S,6R)-6,10-dimethyl-3-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]spiro[4.5]dec-9-en-8-one (PubChem CID 162844429) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (3R,5S,6R)-6,10-dimethyl-3-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]spiro[4.5]dec-9-en-8-one.
| Compound Name | (3R,5S,6R)-6,10-dimethyl-3-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]spiro[4.5]dec-9-en-8-one |
|---|---|
| PubChem CID | 162844429 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (3R,5S,6R)-6,10-dimethyl-3-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]spiro[4.5]dec-9-en-8-one |
| SMILES | CC1=CC(=O)C[C@@H](C)[C@@]12CC[C@@H]([C@@]1(C)COC(C)(C)O1)C2 |
| InChI | InChI=1S/C18H28O3/c1-12-8-15(19)9-13(2)18(12)7-6-14(10-18)17(5)11-20-16(3,4)21-17/h8,13-14H,6-7,9-11H2,1-5H3/t13-,14-,17-,18-/m1/s1 |
| InChIKey | MHKGRXHGSXALIB-DTTOXWODSA-N |
| XLogP | 3.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |