C17H22O3 — CID 162845169
[(6R,7E,13S)-13-hydroxypentadeca-7,14-dien-9,11-diyn-6-yl] acetate (PubChem CID 162845169) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is [(6R,7E,13S)-13-hydroxypentadeca-7,14-dien-9,11-diyn-6-yl] acetate.
| Compound Name | [(6R,7E,13S)-13-hydroxypentadeca-7,14-dien-9,11-diyn-6-yl] acetate |
|---|---|
| PubChem CID | 162845169 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | [(6R,7E,13S)-13-hydroxypentadeca-7,14-dien-9,11-diyn-6-yl] acetate |
| SMILES | C=C[C@H](O)C#CC#C/C=C/[C@@H](CCCCC)OC(C)=O |
| InChI | InChI=1S/C17H22O3/c1-4-6-9-13-17(20-15(3)18)14-11-8-7-10-12-16(19)5-2/h5,11,14,16-17,19H,2,4,6,9,13H2,1,3H3/b14-11+/t16-,17+/m0/s1 |
| InChIKey | DHRILYPSUUVCTB-RRWNYDGOSA-N |
| XLogP | 2.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|