C19H22O6 — CID 162845319
(9-methyl-3,6-dimethylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl) 2,4-dihydroxybut-2-enoate (PubChem CID 162845319) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is (9-methyl-3,6-dimethylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl) 2,4-dihydroxybut-2-enoate.
| Compound Name | (9-methyl-3,6-dimethylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl) 2,4-dihydroxybut-2-enoate |
|---|---|
| PubChem CID | 162845319 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (9-methyl-3,6-dimethylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl) 2,4-dihydroxybut-2-enoate |
| SMILES | C=C1CC(OC(=O)C(O)=CCO)C2C(=C)C(=O)OC2C2C(C)=CCC12 |
| InChI | InChI=1S/C19H22O6/c1-9-4-5-12-10(2)8-14(24-19(23)13(21)6-7-20)16-11(3)18(22)25-17(16)15(9)12/h4,6,12,14-17,20-21H,2-3,5,7-8H2,1H3 |
| InChIKey | LLEISBHTKVIJHY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|