C23H23NO3S — CID 16284554
N-(1-([1,1'-Biphenyl]-4-yl)ethyl)-4-((methylsulfonyl)methyl)benzamide (PubChem CID 16284554) has the molecular formula C23H23NO3S and a molecular weight of 393.50 g/mol. Its IUPAC name is 4-(methylsulfonylmethyl)-N-[1-(4-phenylphenyl)ethyl]benzamide.
| Compound Name | N-(1-([1,1'-Biphenyl]-4-yl)ethyl)-4-((methylsulfonyl)methyl)benzamide |
|---|---|
| PubChem CID | 16284554 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 4-(methylsulfonylmethyl)-N-[1-(4-phenylphenyl)ethyl]benzamide |
| SMILES | CC(C1=CC=C(C=C1)C2=CC=CC=C2)NC(=O)C3=CC=C(C=C3)CS(=O)(=O)C |
| InChI | InChI=1S/C23H23NO3S/c1-17(19-12-14-21(15-13-19)20-6-4-3-5-7-20)24-23(25)22-10-8-18(9-11-22)16-28(2,26)27/h3-15,17H,16H2,1-2H3,(H,24,25) |
| InChIKey | JNCOLCWGDJAZIG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 71.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | 590 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |