C26H44O3 — CID 162845959
[(3R,7S,10R,11R)-10-hydroxy-3,7,11-trimethylhexadecyl] benzoate (PubChem CID 162845959) has the molecular formula C26H44O3 and a molecular weight of 404.64 g/mol. Its IUPAC name is [(3R,7S,10R,11R)-10-hydroxy-3,7,11-trimethylhexadecyl] benzoate.
| Compound Name | [(3R,7S,10R,11R)-10-hydroxy-3,7,11-trimethylhexadecyl] benzoate |
|---|---|
| PubChem CID | 162845959 |
| Molecular Formula | C26H44O3 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.33 |
| IUPAC Name | [(3R,7S,10R,11R)-10-hydroxy-3,7,11-trimethylhexadecyl] benzoate |
| SMILES | CCCCC[C@@H](C)[C@H](O)CC[C@@H](C)CCC[C@@H](C)CCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H44O3/c1-5-6-8-14-23(4)25(27)18-17-21(2)12-11-13-22(3)19-20-29-26(28)24-15-9-7-10-16-24/h7,9-10,15-16,21-23,25,27H,5-6,8,11-14,17-20H2,1-4H3/t21-,22+,23+,25+/m0/s1 |
| InChIKey | KWMDECCDBHDQSM-XJTUCQONSA-N |
| XLogP | 7.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|