C17H24O5 — CID 162846008
(1R,2S,6R,7R,9R,12S,13S,18R)-6,13-dihydroxy-12-methyl-10,14-dioxapentacyclo[11.2.2.11,9.02,7.012,18]octadecan-11-one (PubChem CID 162846008) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is (1R,2S,6R,7R,9R,12S,13S,18R)-6,13-dihydroxy-12-methyl-10,14-dioxapentacyclo[11.2.2.11,9.02,7.012,18]octadecan-11-one.
| Compound Name | (1R,2S,6R,7R,9R,12S,13S,18R)-6,13-dihydroxy-12-methyl-10,14-dioxapentacyclo[11.2.2.11,9.02,7.012,18]octadecan-11-one |
|---|---|
| PubChem CID | 162846008 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (1R,2S,6R,7R,9R,12S,13S,18R)-6,13-dihydroxy-12-methyl-10,14-dioxapentacyclo[11.2.2.11,9.02,7.012,18]octadecan-11-one |
| SMILES | C[C@@]12C(=O)O[C@@H]3C[C@H]4[C@H](O)CCC[C@@H]4[C@]4(CC[C@]1(O)OC4)[C@@H]32 |
| InChI | InChI=1S/C17H24O5/c1-15-13-12(22-14(15)19)7-9-10(3-2-4-11(9)18)16(13)5-6-17(15,20)21-8-16/h9-13,18,20H,2-8H2,1H3/t9-,10+,11-,12-,13+,15-,16-,17+/m1/s1 |
| InChIKey | BGJDWCQXJDACLG-GILCIXSLSA-N |
| XLogP | 1.21 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |