C30H50O15 — CID 162846132
[(2R,3R,4S,5R,6R)-5-acetyloxy-6-[(2S,3S,4R,5R)-3-hexanoyloxy-4-hydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-2-(hydroxymethyl)-4-(2-methylpropanoyloxy)oxan-3-yl] hexanoate (PubChem CID 162846132) has the molecular formula C30H50O15 and a molecular weight of 650.71 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-5-acetyloxy-6-[(2S,3S,4R,5R)-3-hexanoyloxy-4-hydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-2-(hydroxymethyl)-4-(2-methylpropanoyloxy)oxan-3-yl] hexanoate.
| Compound Name | [(2R,3R,4S,5R,6R)-5-acetyloxy-6-[(2S,3S,4R,5R)-3-hexanoyloxy-4-hydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-2-(hydroxymethyl)-4-(2-methylpropanoyloxy)oxan-3-yl] hexanoate |
|---|---|
| PubChem CID | 162846132 |
| Molecular Formula | C30H50O15 |
| Molecular Weight | 650.71 g/mol |
| Exact Mass | 650.31 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-5-acetyloxy-6-[(2S,3S,4R,5R)-3-hexanoyloxy-4-hydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-2-(hydroxymethyl)-4-(2-methylpropanoyloxy)oxan-3-yl] hexanoate |
| SMILES | CCCCCC(=O)O[C@H]1[C@H](OC(=O)C(C)C)[C@@H](OC(C)=O)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2OC(=O)CCCCC)O[C@@H]1CO |
| InChI | InChI=1S/C30H50O15/c1-6-8-10-12-21(35)41-24-20(15-32)40-29(26(39-18(5)34)25(24)43-28(38)17(3)4)45-30(16-33)27(23(37)19(14-31)44-30)42-22(36)13-11-9-7-2/h17,19-20,23-27,29,31-33,37H,6-16H2,1-5H3/t19-,20-,23-,24-,25+,26-,27+,29-,30+/m1/s1 |
| InChIKey | BVFYJVCMRWNZTQ-KJCPGIIQSA-N |
| XLogP | 0.64 |
| TPSA | 213.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.71 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|