C22H32O4 — CID 162846614
[(1S,3aR,4R,7aR)-7,7a-diformyl-3a-methyl-1-[(2S)-6-methylhept-5-en-2-yl]-2,3,4,5-tetrahydro-1H-inden-4-yl] acetate (PubChem CID 162846614) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [(1S,3aR,4R,7aR)-7,7a-diformyl-3a-methyl-1-[(2S)-6-methylhept-5-en-2-yl]-2,3,4,5-tetrahydro-1H-inden-4-yl] acetate.
| Compound Name | [(1S,3aR,4R,7aR)-7,7a-diformyl-3a-methyl-1-[(2S)-6-methylhept-5-en-2-yl]-2,3,4,5-tetrahydro-1H-inden-4-yl] acetate |
|---|---|
| PubChem CID | 162846614 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [(1S,3aR,4R,7aR)-7,7a-diformyl-3a-methyl-1-[(2S)-6-methylhept-5-en-2-yl]-2,3,4,5-tetrahydro-1H-inden-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC=C(C=O)[C@@]2(C=O)[C@H]([C@@H](C)CCC=C(C)C)CC[C@@]12C |
| InChI | InChI=1S/C22H32O4/c1-15(2)7-6-8-16(3)19-11-12-21(5)20(26-17(4)25)10-9-18(13-23)22(19,21)14-24/h7,9,13-14,16,19-20H,6,8,10-12H2,1-5H3/t16-,19-,20+,21-,22-/m0/s1 |
| InChIKey | BLWONUNUDGLKHV-SSCXBUAASA-N |
| XLogP | 4.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|