C30H50O6 — CID 162846697
8,10,12-trihydroxy-11,13,15,17,19-pentamethyl-20-(4-oxohexyl)-1-oxacycloicosa-3,5,15-trien-2-one (PubChem CID 162846697) has the molecular formula C30H50O6 and a molecular weight of 506.72 g/mol. Its IUPAC name is 8,10,12-trihydroxy-11,13,15,17,19-pentamethyl-20-(4-oxohexyl)-1-oxacycloicosa-3,5,15-trien-2-one.
| Compound Name | 8,10,12-trihydroxy-11,13,15,17,19-pentamethyl-20-(4-oxohexyl)-1-oxacycloicosa-3,5,15-trien-2-one |
|---|---|
| PubChem CID | 162846697 |
| Molecular Formula | C30H50O6 |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.36 |
| IUPAC Name | 8,10,12-trihydroxy-11,13,15,17,19-pentamethyl-20-(4-oxohexyl)-1-oxacycloicosa-3,5,15-trien-2-one |
| SMILES | CCC(=O)CCCC1OC(=O)C=CC=CCC(O)CC(O)C(C)C(O)C(C)CC(C)=CC(C)CC1C |
| InChI | InChI=1S/C30H50O6/c1-7-25(31)13-11-14-28-22(4)17-20(2)16-21(3)18-23(5)30(35)24(6)27(33)19-26(32)12-9-8-10-15-29(34)36-28/h8-10,15-16,20,22-24,26-28,30,32-33,35H,7,11-14,17-19H2,1-6H3 |
| InChIKey | ZGXMNNDLHXNOQU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|