C41H66O12 — CID 162846717
2,2,6a,6b,9,9,12a-heptamethyl-10-[4,5,6-trihydroxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid (PubChem CID 162846717) has the molecular formula C41H66O12 and a molecular weight of 750.97 g/mol. Its IUPAC name is 2,2,6a,6b,9,9,12a-heptamethyl-10-[4,5,6-trihydroxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid.
| Compound Name | 2,2,6a,6b,9,9,12a-heptamethyl-10-[4,5,6-trihydroxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
|---|---|
| PubChem CID | 162846717 |
| Molecular Formula | C41H66O12 |
| Molecular Weight | 750.97 g/mol |
| Exact Mass | 750.46 |
| IUPAC Name | 2,2,6a,6b,9,9,12a-heptamethyl-10-[4,5,6-trihydroxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| SMILES | CC1OC(OC2C(OC3CCC4(C)C(CCC5(C)C4CC=C4C6CC(C)(C)CCC6(C(=O)O)CCC45C)C3(C)C)OC(O)C(O)C2O)C(O)C(O)C1O |
| InChI | InChI=1S/C41H66O12/c1-20-26(42)27(43)30(46)33(50-20)52-31-28(44)29(45)32(47)53-34(31)51-25-12-13-38(6)23(37(25,4)5)11-14-40(8)24(38)10-9-21-22-19-36(2,3)15-17-41(22,35(48)49)18-16-39(21,40)7/h9,20,22-34,42-47H,10-19H2,1-8H3,(H,48,49) |
| InChIKey | CXFDBCFMPVZJHG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 195.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.97 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|