C26H32O9 — CID 162846961
(3S)-3-[(1R,2S,4R,7S,8R,11S,12R,16S)-7-(furan-3-yl)-1,8,15,15-tetramethyl-5,18-dioxo-3,6,14-trioxapentacyclo[9.7.0.02,4.02,8.012,16]octadecan-12-yl]-3-hydroxypropanoic acid (PubChem CID 162846961) has the molecular formula C26H32O9 and a molecular weight of 488.53 g/mol. Its IUPAC name is (3S)-3-[(1R,2S,4R,7S,8R,11S,12R,16S)-7-(furan-3-yl)-1,8,15,15-tetramethyl-5,18-dioxo-3,6,14-trioxapentacyclo[9.7.0.02,4.02,8.012,16]octadecan-12-yl]-3-hydroxypropanoic acid.
| Compound Name | (3S)-3-[(1R,2S,4R,7S,8R,11S,12R,16S)-7-(furan-3-yl)-1,8,15,15-tetramethyl-5,18-dioxo-3,6,14-trioxapentacyclo[9.7.0.02,4.02,8.012,16]octadecan-12-yl]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 162846961 |
| Molecular Formula | C26H32O9 |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | (3S)-3-[(1R,2S,4R,7S,8R,11S,12R,16S)-7-(furan-3-yl)-1,8,15,15-tetramethyl-5,18-dioxo-3,6,14-trioxapentacyclo[9.7.0.02,4.02,8.012,16]octadecan-12-yl]-3-hydroxypropanoic acid |
| SMILES | CC1(C)OC[C@]2([C@@H](O)CC(=O)O)[C@@H]1CC(=O)[C@]1(C)[C@H]2CC[C@]2(C)[C@H](c3ccoc3)OC(=O)[C@@H]3O[C@@]321 |
| InChI | InChI=1S/C26H32O9/c1-22(2)15-9-16(27)24(4)14(25(15,12-33-22)17(28)10-18(29)30)5-7-23(3)19(13-6-8-32-11-13)34-21(31)20-26(23,24)35-20/h6,8,11,14-15,17,19-20,28H,5,7,9-10,12H2,1-4H3,(H,29,30)/t14-,15-,17+,19+,20+,23-,24+,25-,26+/m1/s1 |
| InChIKey | SZSLZBYOLTYIOE-QTVIWVOHSA-N |
| XLogP | 2.66 |
| TPSA | 135.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|