C19H24O6 — CID 162847476
[(1R,3R,6R,8R,9R)-9-[(1R)-1-acetyloxy-4-methyl-2-oxopent-3-enyl]-4-methyl-7-oxatricyclo[4.3.0.03,9]non-4-en-8-yl] acetate (PubChem CID 162847476) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is [(1R,3R,6R,8R,9R)-9-[(1R)-1-acetyloxy-4-methyl-2-oxopent-3-enyl]-4-methyl-7-oxatricyclo[4.3.0.03,9]non-4-en-8-yl] acetate.
| Compound Name | [(1R,3R,6R,8R,9R)-9-[(1R)-1-acetyloxy-4-methyl-2-oxopent-3-enyl]-4-methyl-7-oxatricyclo[4.3.0.03,9]non-4-en-8-yl] acetate |
|---|---|
| PubChem CID | 162847476 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | [(1R,3R,6R,8R,9R)-9-[(1R)-1-acetyloxy-4-methyl-2-oxopent-3-enyl]-4-methyl-7-oxatricyclo[4.3.0.03,9]non-4-en-8-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@@H]2C=C(C)[C@H]3C[C@@H]2[C@]13[C@@H](OC(C)=O)C(=O)C=C(C)C |
| InChI | InChI=1S/C19H24O6/c1-9(2)6-15(22)17(23-11(4)20)19-13-8-14(19)16(7-10(13)3)25-18(19)24-12(5)21/h6-7,13-14,16-18H,8H2,1-5H3/t13-,14+,16-,17+,18+,19-/m1/s1 |
| InChIKey | QFUYTTKICOKMGU-SFPCTXLHSA-N |
| XLogP | 2.32 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|