About 4-[(3-hydroxy-2,6-dimethylphenyl)methyl]-5,5-dimethyloxolan-2-one
4-[(3-hydroxy-2,6-dimethylphenyl)methyl]-5,5-dimethyloxolan-2-one (PubChem CID 162847491) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is 4-[(3-hydroxy-2,6-dimethylphenyl)methyl]-5,5-dimethyloxolan-2-one.
Molecular Properties
| Compound Name | 4-[(3-hydroxy-2,6-dimethylphenyl)methyl]-5,5-dimethyloxolan-2-one |
| PubChem CID | 162847491 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 4-[(3-hydroxy-2,6-dimethylphenyl)methyl]-5,5-dimethyloxolan-2-one |
| SMILES | Cc1ccc(O)c(C)c1CC1CC(=O)OC1(C)C |
| InChI | InChI=1S/C15H20O3/c1-9-5-6-13(16)10(2)12(9)7-11-8-14(17)18-15(11,3)4/h5-6,11,16H,7-8H2,1-4H3 |
| InChIKey | NTSBAYOUJHKJPT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(3-hydroxy-2,6-dimethylphenyl)methyl]-5,5-dimethyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-hydroxy-2,6-dimethylphenyl)methyl]-5,5-dimethyloxolan-2-one?
The IUPAC name of 4-[(3-hydroxy-2,6-dimethylphenyl)methyl]-5,5-dimethyloxolan-2-one (CID 162847491) is 4-[(3-hydroxy-2,6-dimethylphenyl)methyl]-5,5-dimethyloxolan-2-one.
What is the SMILES notation for 4-[(3-hydroxy-2,6-dimethylphenyl)methyl]-5,5-dimethyloxolan-2-one?
The canonical SMILES for 4-[(3-hydroxy-2,6-dimethylphenyl)methyl]-5,5-dimethyloxolan-2-one is Cc1ccc(O)c(C)c1CC1CC(=O)OC1(C)C.
What is the InChIKey of 4-[(3-hydroxy-2,6-dimethylphenyl)methyl]-5,5-dimethyloxolan-2-one?
The InChIKey is NTSBAYOUJHKJPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3/c1-9-5-6-13(16)10(2)12(9)7-11-8-14(17)18-15(11,3)4/h5-6,11,16H,7-8H2,1-4H3.
What are the key properties of 4-[(3-hydroxy-2,6-dimethylphenyl)methyl]-5,5-dimethyloxolan-2-one?
4-[(3-hydroxy-2,6-dimethylphenyl)methyl]-5,5-dimethyloxolan-2-one has a molecular weight of 248.32 g/mol, XLogP of 2.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-hydroxy-2,6-dimethylphenyl)methyl]-5,5-dimethyloxolan-2-one is sourced from PubChem (CID 162847491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).