C11H16O2 — CID 162847541
(5R)-5-methoxy-4,6,6-trimethylcyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 162847541) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (5R)-5-methoxy-4,6,6-trimethylcyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | (5R)-5-methoxy-4,6,6-trimethylcyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 162847541 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (5R)-5-methoxy-4,6,6-trimethylcyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | CO[C@@H]1C(C)=CC=C(C=O)C1(C)C |
| InChI | InChI=1S/C11H16O2/c1-8-5-6-9(7-12)11(2,3)10(8)13-4/h5-7,10H,1-4H3/t10-/m1/s1 |
| InChIKey | WFMHNOKCEJZJKZ-SNVBAGLBSA-N |
| XLogP | 2.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|