C20H34O5 — CID 162847641
(3R,3aR,4R,6S,9E,11R,11aS)-11-hydroxy-6-(hydroxymethyl)-3,10-dimethyl-4-[(2S)-2-methylbutoxy]-3a,4,5,6,7,8,11,11a-octahydro-3H-cyclodeca[b]furan-2-one (PubChem CID 162847641) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is (3R,3aR,4R,6S,9E,11R,11aS)-11-hydroxy-6-(hydroxymethyl)-3,10-dimethyl-4-[(2S)-2-methylbutoxy]-3a,4,5,6,7,8,11,11a-octahydro-3H-cyclodeca[b]furan-2-one.
| Compound Name | (3R,3aR,4R,6S,9E,11R,11aS)-11-hydroxy-6-(hydroxymethyl)-3,10-dimethyl-4-[(2S)-2-methylbutoxy]-3a,4,5,6,7,8,11,11a-octahydro-3H-cyclodeca[b]furan-2-one |
|---|---|
| PubChem CID | 162847641 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (3R,3aR,4R,6S,9E,11R,11aS)-11-hydroxy-6-(hydroxymethyl)-3,10-dimethyl-4-[(2S)-2-methylbutoxy]-3a,4,5,6,7,8,11,11a-octahydro-3H-cyclodeca[b]furan-2-one |
| SMILES | CC[C@H](C)CO[C@@H]1C[C@@H](CO)CC/C=C(\C)[C@@H](O)[C@H]2OC(=O)[C@H](C)[C@@H]21 |
| InChI | InChI=1S/C20H34O5/c1-5-12(2)11-24-16-9-15(10-21)8-6-7-13(3)18(22)19-17(16)14(4)20(23)25-19/h7,12,14-19,21-22H,5-6,8-11H2,1-4H3/b13-7+/t12-,14+,15-,16+,17+,18+,19-/m0/s1 |
| InChIKey | IWFZPNVCTDXDMP-TVOYGJSRSA-N |
| XLogP | 2.69 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|