C17H25N3O5 — CID 162847650
1-[4-hydroxy-5-(morpholin-4-ylmethyl)oxolan-3-yl]-3-(3-methoxyphenyl)urea (PubChem CID 162847650) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is 1-[4-hydroxy-5-(morpholin-4-ylmethyl)oxolan-3-yl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[4-hydroxy-5-(morpholin-4-ylmethyl)oxolan-3-yl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 162847650 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-[4-hydroxy-5-(morpholin-4-ylmethyl)oxolan-3-yl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)NC2COC(CN3CCOCC3)C2O)c1 |
| InChI | InChI=1S/C17H25N3O5/c1-23-13-4-2-3-12(9-13)18-17(22)19-14-11-25-15(16(14)21)10-20-5-7-24-8-6-20/h2-4,9,14-16,21H,5-8,10-11H2,1H3,(H2,18,19,22) |
| InChIKey | MMDUFKXNIXMQAP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |