C15H26O3 — CID 162847766
(3E,6E,8S,10R)-2,6,10-trimethyldodeca-3,6,11-triene-2,8,10-triol (PubChem CID 162847766) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (3E,6E,8S,10R)-2,6,10-trimethyldodeca-3,6,11-triene-2,8,10-triol.
| Compound Name | (3E,6E,8S,10R)-2,6,10-trimethyldodeca-3,6,11-triene-2,8,10-triol |
|---|---|
| PubChem CID | 162847766 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (3E,6E,8S,10R)-2,6,10-trimethyldodeca-3,6,11-triene-2,8,10-triol |
| SMILES | C=C[C@](C)(O)C[C@H](O)/C=C(\C)C/C=C/C(C)(C)O |
| InChI | InChI=1S/C15H26O3/c1-6-15(5,18)11-13(16)10-12(2)8-7-9-14(3,4)17/h6-7,9-10,13,16-18H,1,8,11H2,2-5H3/b9-7+,12-10+/t13-,15+/m1/s1 |
| InChIKey | ZXFZSYKYILJHBU-HYDLWCNDSA-N |
| XLogP | 2.34 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|