C20H32O4 — CID 162847899
1-[(1R,6R,8S,9R,10S)-8,9-dihydroxy-6,10-dimethyl-2-methylidene-12-oxatricyclo[7.2.1.01,6]dodecan-10-yl]-4-methylpentan-3-one (PubChem CID 162847899) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is 1-[(1R,6R,8S,9R,10S)-8,9-dihydroxy-6,10-dimethyl-2-methylidene-12-oxatricyclo[7.2.1.01,6]dodecan-10-yl]-4-methylpentan-3-one.
| Compound Name | 1-[(1R,6R,8S,9R,10S)-8,9-dihydroxy-6,10-dimethyl-2-methylidene-12-oxatricyclo[7.2.1.01,6]dodecan-10-yl]-4-methylpentan-3-one |
|---|---|
| PubChem CID | 162847899 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 1-[(1R,6R,8S,9R,10S)-8,9-dihydroxy-6,10-dimethyl-2-methylidene-12-oxatricyclo[7.2.1.01,6]dodecan-10-yl]-4-methylpentan-3-one |
| SMILES | C=C1CCC[C@]2(C)C[C@H](O)[C@]3(O)O[C@]12C[C@]3(C)CCC(=O)C(C)C |
| InChI | InChI=1S/C20H32O4/c1-13(2)15(21)8-10-18(5)12-19-14(3)7-6-9-17(19,4)11-16(22)20(18,23)24-19/h13,16,22-23H,3,6-12H2,1-2,4-5H3/t16-,17+,18-,19+,20-/m0/s1 |
| InChIKey | PXEKVOBSMMMKPX-YHDCXSKOSA-N |
| XLogP | 3.36 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|