About 2-methyl-5-[(2S,5R)-2-methyl-5-prop-1-en-2-yloxolan-2-yl]furan
2-methyl-5-[(2S,5R)-2-methyl-5-prop-1-en-2-yloxolan-2-yl]furan (PubChem CID 162848161) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 2-methyl-5-[(2S,5R)-2-methyl-5-prop-1-en-2-yloxolan-2-yl]furan.
Molecular Properties
| Compound Name | 2-methyl-5-[(2S,5R)-2-methyl-5-prop-1-en-2-yloxolan-2-yl]furan |
| PubChem CID | 162848161 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-methyl-5-[(2S,5R)-2-methyl-5-prop-1-en-2-yloxolan-2-yl]furan |
| SMILES | C=C(C)[C@H]1CC[C@@](C)(c2ccc(C)o2)O1 |
| InChI | InChI=1S/C13H18O2/c1-9(2)11-7-8-13(4,15-11)12-6-5-10(3)14-12/h5-6,11H,1,7-8H2,2-4H3/t11-,13+/m1/s1 |
| InChIKey | CCGNVBQNOBXWAI-YPMHNXCESA-N |
| XLogP | 3.56 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-[(2S,5R)-2-methyl-5-prop-1-en-2-yloxolan-2-yl]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-[(2S,5R)-2-methyl-5-prop-1-en-2-yloxolan-2-yl]furan?
The IUPAC name of 2-methyl-5-[(2S,5R)-2-methyl-5-prop-1-en-2-yloxolan-2-yl]furan (CID 162848161) is 2-methyl-5-[(2S,5R)-2-methyl-5-prop-1-en-2-yloxolan-2-yl]furan.
What is the SMILES notation for 2-methyl-5-[(2S,5R)-2-methyl-5-prop-1-en-2-yloxolan-2-yl]furan?
The canonical SMILES for 2-methyl-5-[(2S,5R)-2-methyl-5-prop-1-en-2-yloxolan-2-yl]furan is C=C(C)[C@H]1CC[C@@](C)(c2ccc(C)o2)O1.
What is the InChIKey of 2-methyl-5-[(2S,5R)-2-methyl-5-prop-1-en-2-yloxolan-2-yl]furan?
The InChIKey is CCGNVBQNOBXWAI-YPMHNXCESA-N. The full InChI is InChI=1S/C13H18O2/c1-9(2)11-7-8-13(4,15-11)12-6-5-10(3)14-12/h5-6,11H,1,7-8H2,2-4H3/t11-,13+/m1/s1.
What are the key properties of 2-methyl-5-[(2S,5R)-2-methyl-5-prop-1-en-2-yloxolan-2-yl]furan?
2-methyl-5-[(2S,5R)-2-methyl-5-prop-1-en-2-yloxolan-2-yl]furan has a molecular weight of 206.28 g/mol, XLogP of 3.56, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-[(2S,5R)-2-methyl-5-prop-1-en-2-yloxolan-2-yl]furan is sourced from PubChem (CID 162848161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).