C32H52O4 — CID 162848793
[(E,2S,3S,6R)-7-hydroxy-2-[(3R,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylhept-4-en-3-yl] acetate (PubChem CID 162848793) has the molecular formula C32H52O4 and a molecular weight of 500.76 g/mol. Its IUPAC name is [(E,2S,3S,6R)-7-hydroxy-2-[(3R,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylhept-4-en-3-yl] acetate.
| Compound Name | [(E,2S,3S,6R)-7-hydroxy-2-[(3R,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylhept-4-en-3-yl] acetate |
|---|---|
| PubChem CID | 162848793 |
| Molecular Formula | C32H52O4 |
| Molecular Weight | 500.76 g/mol |
| Exact Mass | 500.39 |
| IUPAC Name | [(E,2S,3S,6R)-7-hydroxy-2-[(3R,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylhept-4-en-3-yl] acetate |
| SMILES | CC(=O)O[C@@H](/C=C/[C@@H](C)CO)[C@@H](C)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@@H](O)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C32H52O4/c1-20(19-33)9-11-26(36-22(3)34)21(2)23-13-17-32(8)25-10-12-27-29(4,5)28(35)15-16-30(27,6)24(25)14-18-31(23,32)7/h9,11,20-21,23,26-28,33,35H,10,12-19H2,1-8H3/b11-9+/t20-,21+,23-,26+,27+,28-,30-,31-,32+/m1/s1 |
| InChIKey | DZXULBWUASGBPK-KWGRFJFFSA-N |
| XLogP | 6.85 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.76 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|