C34H44O18 — CID 162848810
[6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2-[(3,4,5-trihydroxyoxan-2-yl)methyl]oxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 162848810) has the molecular formula C34H44O18 and a molecular weight of 740.71 g/mol. Its IUPAC name is [6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2-[(3,4,5-trihydroxyoxan-2-yl)methyl]oxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2-[(3,4,5-trihydroxyoxan-2-yl)methyl]oxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162848810 |
| Molecular Formula | C34H44O18 |
| Molecular Weight | 740.71 g/mol |
| Exact Mass | 740.25 |
| IUPAC Name | [6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2-[(3,4,5-trihydroxyoxan-2-yl)methyl]oxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | CC1OC(OC2C(O)C(OCCc3ccc(O)c(O)c3)OC(CC3OCC(O)C(O)C3O)C2OC(=O)C=Cc2ccc(O)c(O)c2)C(O)C(O)C1O |
| InChI | InChI=1S/C34H44O18/c1-14-25(41)28(44)29(45)34(49-14)52-32-30(46)33(47-9-8-16-3-6-18(36)20(38)11-16)50-23(12-22-27(43)26(42)21(39)13-48-22)31(32)51-24(40)7-4-15-2-5-17(35)19(37)10-15/h2-7,10-11,14,21-23,25-39,41-46H,8-9,12-13H2,1H3 |
| InChIKey | RDOVNKACHZOMMC-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 294.98 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.71 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|