C27H44N2 — CID 162848977
(6S,8R,11R,12S,15S,16R)-15-[(1S)-1-(dimethylamino)ethyl]-N,7,7,12,16-pentamethyltetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2,4-trien-6-amine (PubChem CID 162848977) has the molecular formula C27H44N2 and a molecular weight of 396.66 g/mol. Its IUPAC name is (6S,8R,11R,12S,15S,16R)-15-[(1S)-1-(dimethylamino)ethyl]-N,7,7,12,16-pentamethyltetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2,4-trien-6-amine.
| Compound Name | (6S,8R,11R,12S,15S,16R)-15-[(1S)-1-(dimethylamino)ethyl]-N,7,7,12,16-pentamethyltetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2,4-trien-6-amine |
|---|---|
| PubChem CID | 162848977 |
| Molecular Formula | C27H44N2 |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.35 |
| IUPAC Name | (6S,8R,11R,12S,15S,16R)-15-[(1S)-1-(dimethylamino)ethyl]-N,7,7,12,16-pentamethyltetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2,4-trien-6-amine |
| SMILES | CN[C@H]1C=CC2=CC3=CC[C@]4(C)[C@@H]([C@H](C)N(C)C)CC[C@@]4(C)[C@@H]3CC[C@H]2C1(C)C |
| InChI | InChI=1S/C27H44N2/c1-18(29(7)8)21-14-16-27(5)23-11-10-22-19(9-12-24(28-6)25(22,2)3)17-20(23)13-15-26(21,27)4/h9,12-13,17-18,21-24,28H,10-11,14-16H2,1-8H3/t18-,21+,22+,23+,24-,26+,27-/m0/s1 |
| InChIKey | CRZNCBBCJSABDV-WRMBYBKZSA-N |
| XLogP | 5.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |