C39H60O5 — CID 162849207
(19-hydroxy-3,7,7,11,16,20,20-heptamethyl-8-pentacyclo[13.8.0.03,12.06,11.016,21]tricosanyl) 3-(3,4-dihydroxyphenyl)propanoate (PubChem CID 162849207) has the molecular formula C39H60O5 and a molecular weight of 608.90 g/mol. Its IUPAC name is (19-hydroxy-3,7,7,11,16,20,20-heptamethyl-8-pentacyclo[13.8.0.03,12.06,11.016,21]tricosanyl) 3-(3,4-dihydroxyphenyl)propanoate.
| Compound Name | (19-hydroxy-3,7,7,11,16,20,20-heptamethyl-8-pentacyclo[13.8.0.03,12.06,11.016,21]tricosanyl) 3-(3,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 162849207 |
| Molecular Formula | C39H60O5 |
| Molecular Weight | 608.90 g/mol |
| Exact Mass | 608.44 |
| IUPAC Name | (19-hydroxy-3,7,7,11,16,20,20-heptamethyl-8-pentacyclo[13.8.0.03,12.06,11.016,21]tricosanyl) 3-(3,4-dihydroxyphenyl)propanoate |
| SMILES | CC12CCC3C(C)(C)C(OC(=O)CCc4ccc(O)c(O)c4)CCC3(C)C1CCC1C(CCC3C(C)(C)C(O)CCC13C)C2 |
| InChI | InChI=1S/C39H60O5/c1-35(2)29-13-10-25-23-37(5)19-16-30-36(3,4)33(44-34(43)15-9-24-8-12-27(40)28(41)22-24)18-21-39(30,7)31(37)14-11-26(25)38(29,6)20-17-32(35)42/h8,12,22,25-26,29-33,40-42H,9-11,13-21,23H2,1-7H3 |
| InChIKey | GPOAVNGZTCABBJ-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.90 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|