C15H18O3 — CID 162849312
(2S,9S)-9-methyl-3-prop-1-en-2-ylspiro[6,7,8,9-tetrahydro-1-benzoxepine-2,2'-oxirane]-5-one (PubChem CID 162849312) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (2S,9S)-9-methyl-3-prop-1-en-2-ylspiro[6,7,8,9-tetrahydro-1-benzoxepine-2,2'-oxirane]-5-one.
| Compound Name | (2S,9S)-9-methyl-3-prop-1-en-2-ylspiro[6,7,8,9-tetrahydro-1-benzoxepine-2,2'-oxirane]-5-one |
|---|---|
| PubChem CID | 162849312 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (2S,9S)-9-methyl-3-prop-1-en-2-ylspiro[6,7,8,9-tetrahydro-1-benzoxepine-2,2'-oxirane]-5-one |
| SMILES | C=C(C)C1=CC(=O)C2=C(O[C@]13CO3)[C@@H](C)CCC2 |
| InChI | InChI=1S/C15H18O3/c1-9(2)12-7-13(16)11-6-4-5-10(3)14(11)18-15(12)8-17-15/h7,10H,1,4-6,8H2,2-3H3/t10-,15+/m0/s1 |
| InChIKey | CMSREKPPETUFBI-ZUZCIYMTSA-N |
| XLogP | 2.89 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|